N4-Bz-C-(S)-GNA phosphoramidite
N4-Bz-C-(S)-GNA phosphoramidite is a highly specialized chemical reagent, revered for its extensive utility within the bounds of oligonucleotide synthesis—pertinently, for research and diagnostic purposes. A potent activator of modified base introduction into the DNA/RNA sequences, it lends itself distinctively towards the detection and binding of scientific biomolecules. Characterized by its remarkable stability and markedly efficient functionality, its usage has also been attested to in the disciplines of viral infection and cancer diagnosis, making it an invaluable tool in the scientific paradigm.
| Supplier | BOC Sciences |
|---|---|
| Product # | 885322-06-5 |
| Pricing | Inquire |
| Cas | 885322-06-5 |
| Molecular Weight | 791.87 |
| Molecular Formula | C44H50N5O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC(CN1C=CC(=NC1=O)NC(=O)C2=CC=CC=C2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |