2'-b-C-Methyl-6-azauridine
2'-b-C-Methyl-6-azauridine, a nucleoside analogue prodrug, exhibits a robust anti-Hepatitis C virus activity by hindering RNA synthesis and impeding viral replication. In addition, this agent displays tremendous potential in the management of other viral ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-052708 |
| Pricing | Inquire |
| Cas | 172605-95-7 |
| Molecular Weight | 259.22 |
| Molecular Formula | C9H13N3O6 |
| Canonical SMILES | CC1(C(C(OC1N2C(=O)NC(=O)C=N2)CO)O)O |