6-Thioguanosine-5'-O-monophosphate sodium salt
6-Thioguanosine-5'-O-monophosphate sodium salt is an indispensable element in biomedical research, demonstrating its significance as a precursor in the development of anti-viral and anti-neoplastic medications. Its prowess lies in accurately and efficiently targeting viral replication and cancer cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74686-78-5 |
| Pricing | Inquire |
| Cas | 74686-78-5 |
| Molecular Weight | 378.28 (free acid) |
| Molecular Formula | C10H13N5O7PS·xNa |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)([O-])[O-])O)O)NC(=NC2=S)N.[Na+].[Na+] |