Waol B
It is a trihydrofuran derivative with cytotoxicity produced by the strain of Myceliophthora lutea TF-0409. It has very weak anti-staphylococcus aureus activity. In cell culture, its cytoplasmic activity against HL 60, P388, T24, HeLa and A549 was 8-10 times weaker than adriamycin, but its cytoplasmic activity against HL 60/ADM was stronger than adriamycin (IC50 is 2.0 μg/mL). IC50 is 0.2 μg/mL.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02973 |
| Pricing | Inquire |
| Molecular Weight | 268.31 |
| Molecular Formula | C14H20O5 |
| Canonical SMILES | CC=CC1C(C(=CC(C(=O)OC)O)C(O1)C=CC)O |