(±)-Hesperetin 7-O-b-D-glucuronide
Hesperetin 7-O-b-D-glucuronide is a well-known flavonoid glycoside with anti-inflammatory and antioxidant attributes. Consequently, this compound plays a pivotal role in the formulation of pharmacotherapies specifically designed to study inflammation-linked ailments like cancer, cardiovascular disorders and neurodegenerative diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1237479-09-2 |
| Pricing | Inquire |
| Cas | 1237479-09-2 |
| Molecular Weight | 478.40 |
| Molecular Formula | C22H22O12 |
| Canonical SMILES | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O |