4-Methylumbelliferyl 6-O-(tert-butyldiphenylsilyl)-b-D-galactopyranoside
4-Methylumbelliferyl 6-O-(tert-butyldiphenylsilyl)-b-D-galactopyranoside is a biomedicine product used in the detection and analysis of enzyme activity related to diseases like cancer, diabetes, and viral infections. Through its fluorescent properties, it enables researchers to study the glycosidase enzymes, aiding in drug development and understanding the pathogenesis of various diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 296776-03-9 |
| Pricing | Inquire |
| Cas | 296776-03-9 |
| Molecular Weight | 576.71 |
| Molecular Formula | C32H36O8Si |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)CO[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C(C)(C)C)O)O)O |