Benanomicin B
Benanomicin B is produced by the strain of Actinomadura sp. MH193-16F4. A and B have anti-candida, Cryptococcus neoforme, Saccharomyces cerevisiae and other fungal activities, while A has stronger activity. Xylose benamycin A and B showed similar or slightly stronger activity against candida, yeast and Cryptococcus, but decreased activity against aspergillus. The antifungal activity of 2-demethylbenamycin was similar to that of xylose Benamycin A. The synthesized 7-methoxybenamycin had little antifungal activity, but showed inhibitory activity of glucosinolase (EC 3.2.1.20) with IC50 of 60μg/mL.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00279 |
| Pricing | Inquire |
| Cas | 116249-66-2 |
| Molecular Weight | 826.75 |
| Molecular Formula | C39H42N2O18 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C3=CC4=C(C(=C3C5=C2C=C(C(=C5O)C(=O)NC(C)C(=O)O)C)O)C(=O)C6=C(C4=O)C(=CC(=C6)OC)O)O)O)OC7C(C(C(CO7)O)O)O)N |