16α-Methyl Prednisolone 21-Acetate
16α-Methyl Prednisolone 21-Acetate is a synthetic glucocorticoid extensively employed in the biomedical field, showcasing formidable anti-inflammatory and immunosuppressive characteristics, thereby used in the research of several allergic and inflammatory afflictions like asthma, rheumatoid arthritis, dermatitis and select autoimmune disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13209-52-4 |
| Pricing | Inquire |
| Cas | 13209-52-4 |
| Molecular Weight | 416.51 |
| Molecular Formula | C24H32O6 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3C(CC2(C1(C(=O)COC(=O)C)O)C)O)C |