2,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl trichloroacetimidate
2,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl trichloroacetimidate, a versatile and indispensable tool in modern glycosylation chemistry, is a chemical compound that has gained widespread recognition for its utility in the synthesis of complex oligosaccharides. Its intricate molecular architecture and unique reactivity have made it a preferred choice as a protecting group for the selective manipulation of saccharide hydroxyl groups. Its adeptness in glycosylation reactions has enabled the facile construction of structurally diverse carbohydrate derivatives and bioactive molecules, including potent antitumor agents such as Mycalamide B and C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149707-76-6 |
| Pricing | Inquire |
| Cas | 149707-76-6 |
| Molecular Weight | 740.97 |
| Molecular Formula | C36H28Cl3NO10 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=N)C(Cl)(Cl)Cl)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |