Oxytetracycline calcium (1:1)
Oxytetracycline calcium is an antibiotic belonging to the tetracycline class. Oxytetracycline calcium potently inhibits Gram-negative and Gram-positive bacteria. Oxytetracycline calcium is a protein synthesis inhibitor and prevents the binding from aminoacil-tRNA to the complex m-ribosomal RNA. Oxytetracycline calcium also possesses anti-HSV-1 activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7179-50-2 |
| Pricing | Inquire |
| Cas | 7179-50-2 |
| Molecular Weight | 498.50 |
| Molecular Formula | C22H22CaN2O9 |
| Canonical SMILES | CC1(C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4[O-])[O-])O)O)C(=O)N)N(C)C)O)O.[Ca+2] |