Clofibric acid acyl-b-D-glucuronide
Clofibric acid acyl-b-D-glucuronide, a compound widely employed in the biomedical sector, assumes significant prominence as a crucial instrument for comprehending the metabolic intricacies and toxicity nuances of specific pharmaceuticals, such as clofibric acid. Furthermore, its utility extends to elucidating the genesis and repercussions of acyl-glucuronides, entities that wield influence over drug pharmacokinetics while also potentially inciting untoward reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72072-47-0 |
| Pricing | Inquire |
| Cas | 72072-47-0 |
| Molecular Weight | 390.77 |
| Molecular Formula | C16H19ClO9 |
| Canonical SMILES | CC(C)(C(=O)OC1C(C(C(C(O1)C(=O)O)O)O)O)OC2=CC=C(C=C2)Cl |