2-Azidoethyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside
2,3,4,6-Tetra-O-acetyl-b-D-galactopyranoside linked with 2-azidoethyl is a vital organic compound employed to fabricate glycoconjugates and visualize glycosylation in cells. Furthermore, it finds extensive application in comprehending the functionality of galactosidases and their participation in lysosomal storage disorders. Its significance in elucidating the biological pathways calls for deeper scientific investigation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 139888-80-5 |
| Pricing | Inquire |
| Cas | 139888-80-5 |
| Molecular Weight | 417.37 |
| Molecular Formula | C16H23N3O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OCCN=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |