2-Amino-3'-O-methyladenosine
2-Amino-3'-O-methyladenosine, a versatile biomolecule, exhibits promising therapeutic potential in tackling a myriad of pathological conditions, ranging from malignant neoplasms to infectious disorders and inflammatory ailments, and has garnered immense attention as a vital investigative probe for exploring the intricate roles of RNA methylation. Emerging evidence points to the multifaceted role of 2-Amino-3'-O-methyladenosine in impeding tumorigenesis, abating viral propagation, and modulating immune reactivity, thus underscoring its indispensable relevance in the biomedical arena.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-043240 |
| Pricing | Inquire |
| Cas | 80791-88-4 |
| Molecular Weight | 296.28 |
| Molecular Formula | C11H16N6O4 |
| Canonical SMILES | COC1C(OC(C1O)N2C=NC3=C(N=C(N=C32)N)N)CO |