Budesonide EP Impurity B
Budesonide EP Impurity B, known as a synthetic steroid, serves as a profound glucocorticoid receptor agonist in the biomedical domain. Its principal application revolves around the research of pharmaceuticals targeting a wide array of inflammatory and immune-related disorders, including asthma, rheumatoid arthritis and multiple sclerosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1040085-98-0 |
| Pricing | Inquire |
| Cas | 1040085-98-0 |
| Molecular Weight | 402.48 |
| Molecular Formula | C23H30O6 |
| Canonical SMILES | CC1OC2CC3C4CCC5=CC(=O)C=CC5(C4C(CC3(C2(O1)C(=O)CO)C)O)C |