9-Fluorenone
9-Fluorenone (CAS# 486-25-9) is a polycyclic aromatic ketone that has photosensitizing properties and also has the ability to undergo electrochemical polymerization. 9-Fluorenone is used in industry as an initiator in visible-light cured resin systems. 9-Fluorenone has potentially toxic effects on humans, as exposure can cause DNA mutations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 486-25-9 |
| Pricing | Inquire |
| Cas | 486-25-9 |
| Molecular Weight | 180.20 |
| Molecular Formula | C13H8O |
| Canonical SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=O |