6-Bromo-2-fluoro-3-iodophenylboronic acid
6-Bromo-2-fluoro-3-iodophenylboronic acid is an indispensable compound in the biomedical industry and showcases tremendous potential in the drug development of diverse ailments. As a derivative of boronic acid, it harbors great promise in the realm of pharmaceutical development geared towards combatting conditions like cancer, diabetes, and inflammation. Capitalizing on its distinctive chemical composition, this compound paves the way for invaluable revelations in the pursuit of refined therapeutic approaches and breakthrough drug exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1072951-90-6 |
| Pricing | Inquire |
| Cas | 1072951-90-6 |
| Molecular Weight | 344.7 |
| Molecular Formula | C6H4BBrFIO2 |
| Canonical SMILES | B(C1=C(C=CC(=C1F)I)Br)(O)O |