2',7-Dihydroxyflavone
2',7-Dihydroxyflavone (cas# 77298-66-9) is a a flavenoid which, as a class of compounds, have broad pharmacological activity, including binding to biomolecules such as enzymes, hormone carriers, and DNA, chelating transition metal ions, catalyzing electron transport, and scavenging free radicals.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB066474 |
| Pricing | Inquire |
| Cas | 77298-66-9 |
| Molecular Weight | 254.24 |
| Molecular Formula | C15H10O4 |
| Canonical SMILES | C1=CC=C(C(=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)O)O |