2-Borono-5-chloro-1H-indole-1-carboxylic acid 1-(1,1-dimethylethyl) ester
2-Borono-5-chloro-1H-indole-1-carboxylic acid 1-(1,1-dimethylethyl) ester, a bespoke chemical, crucially employed in biomedicine. It's distinctively characterized by catalyzing the synthesis of myriad drug-like entities, predominantly in the expansive domain of neuropharmacology, with targeted applications for central nervous system disorders.
Supplier | BOC Sciences |
---|---|
Product # | 475102-12-6 |
Pricing | Inquire |
Cas | 475102-12-6 |
Molecular Weight | 295.53 |
Molecular Formula | C13H15BClNO4 |
Canonical SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Cl)(O)O |