(4E,15E)-Bilirubin acyl-b-D-glucuronide
Bilirubin acyl-b-D-glucuronide, an amalgamation of monoglucuronides, serves as an indispensable tool within the biomedical realm, facilitating in-depth exploration of bilirubin metabolism and its associated ailments. Its profound significance lies in the elucidation of therapeutic agents and methodologies tailored to combat conditions such as jaundice, hepatic disorders, and impairments linked to the eradication of bilirubin.
| Supplier | BOC Sciences |
|---|---|
| Product # | 874448-90-5 |
| Pricing | Inquire |
| Cas | 874448-90-5 |
| Molecular Weight | 760.79 |
| Molecular Formula | C39H44N4O12 |
| Canonical SMILES | CC1=C(NC(=C1CCC(=O)O)CC2=C(C(=C(N2)C=C3C(=C(C(=O)N3)C=C)C)C)CCC(=O)OC4C(C(C(C(O4)C(=O)O)O)O)O)C=C5C(=C(C(=O)N5)C)C=C |