Phenyl Sulfate Sodium Salt
Phenyl Sulfate Sodium Salt is a biomedical product commonly used in the drug development of various drug overdoses and acute poisonings. It acts as an effective antidote by accelerating the elimination of toxins.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14276-99-4 |
| Pricing | Inquire |
| Cas | 14276-99-4 |
| Molecular Weight | 196.16 |
| Molecular Formula | C6H5O4SNa |
| Canonical SMILES | C1=CC=C(C=C1)OS(=O)(=O)[O-].[Na+] |