Resorufin acetate
Resorufin Acetate is a pink fluorescent substrate for hydrolytic enzymes such as cytosolic aldehyde dehydrogenase (ALDH1A1) esterase and chymotrypsin. Upon enzymatic cleavage, the resorufin anion emits red fluorescence (ex/em maxima = 571/585 nm, respectively) used to quantify enzyme activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1152-14-3 |
| Pricing | Inquire |
| Cas | 1152-14-3 |
| Molecular Weight | 255.2 |
| Molecular Formula | C14H9NO4 |
| Canonical SMILES | CC(=O)OC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |