6-Chloro-1H-indol-3-yl b-D-glucuronide
6-Chloro-1H-indol-3-yl b-D-glucuronide is an indispensable compound in the realm of compound, exhibiting immense potential for the research of a myriad of ailments, encompassing cancer, inflammation and metabolic disorders. Furthermore, it serves as an invaluable research instrument, facilitating an in-depth exploration of the intricate mechanisms underpinning drug metabolism, toxicity and efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138182-19-1 |
| Pricing | Inquire |
| Cas | 138182-19-1 |
| Molecular Weight | 343.72 |
| Molecular Formula | C14H14ClNO7 |
| Canonical SMILES | C1=CC2=C(C=C1Cl)NC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O |