Doxycycline EP Impurity B
Meclocycline is a semi-synthetic tetracycline prepared by dehydrating the 6-hydroxyl group of oxytetracycline. It has a wide range of antibacterial and antiprotozoal activities. Meclocycline is an impurity of Doxycycline, which is a semisynthetic, broad-spectrum tetracycline antibiotic used in the treatment of infections caused by bacteria and certain parasites.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03960 |
| Pricing | Inquire |
| Cas | 914-00-1 |
| Molecular Weight | 442.42 |
| Molecular Formula | C22H22N2O8 |
| Canonical SMILES | O=C(N)C=1C(=O)C2(O)C(O)=C3C(=O)C=4C(O)=CC=CC4C(=C)C3C(O)C2C(C1O)N(C)C |