1-(p-Toluenesulfonyl)pyrrole-2-boronic acid MIDA ester
MIDA boronate involved in regioselective cross-coupling for synthesis of highly substituted biaryl scaffoldsReactant for:Synthesis of atropisomerically defined, highly substituted biaryl scaffolds through catalytic enantioselective bromination and regioselective cross-couplingMIDA boronates as stable boronic acid surrogates for classically challenging cross-couplings.Suzuki Cross-Coupling with MIDA Boronates
| Supplier | BOC Sciences |
|---|---|
| Product # | 1311484-50-0 |
| Pricing | Inquire |
| Cas | 1311484-50-0 |
| Molecular Weight | 376.19 |
| Molecular Formula | C16H17BN2O6S |
| Canonical SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=CN2S(=O)(=O)C3=CC=C(C=C3)C |