3'-dGTP
3'-dGTP, a nucleotide analog extensively employed in DNA and RNA molecule synthesis, is a multi-utility molecule with its applications extending to DNA replication and repair mechanisms, treating viral infections, and cancer. With its ability to act as a molecular probe, 3'-dGTP becomes a fascinating choice for exploring protein-nucleic acid interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55968-37-1 |
| Pricing | Inquire |
| Cas | 55968-37-1 |
| Molecular Weight | 507.18 (free acid) |
| Molecular Formula | C10H16N5O13P3 (free acid) |
| Canonical SMILES | C1C(OC(C1O)N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |