7-Deaza-7-propargylamino-dATP
7-Deaza-7-propargylamino-dATP is a paramount instrument in the realm of biomedical investigation, emerging as an indispensable nucleotide analogue, facilitating the meticulous scrutiny of DNA and RNA research. Its usage prevails in unraveling the intricate mechanisms of DNA reparation and the discernment of nucleic acid labeling.
| Supplier | BOC Sciences |
|---|---|
| Product # | 587848-72-4 |
| Pricing | Inquire |
| Cas | 587848-72-4 |
| Molecular Weight | 543.26 (free acid) |
| Molecular Formula | C14H20N5O12P3 (free acid) |
| Canonical SMILES | C1C(C(OC1N2C=C(C3=C(N=CN=C32)N)C#CCN)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |