Murideoxycholic acid
Murideoxycholic acid is a cholesterol derivative and a metabolite of lithocholic acid in liver S9 fractions from humans and other species. Murocholic acid prevents gallstone formation in hamsters fed a lithogenic diet but does not resolve gallstones in prairie dogs fed a high cholesterol diet.
| Supplier | BOC Sciences |
|---|---|
| Product # | 668-49-5 |
| Pricing | Inquire |
| Cas | 668-49-5 |
| Molecular Weight | 392.58 |
| Molecular Formula | C24H40O4 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2CC(C4C3(CCC(C4)O)C)O)C |