3,4-Difluoro U-50488 Hydrochloride
3,4-Difluoro U-50488 Hydrochloride is a derivative of (+/-)-U-50488 Hydrochloride(U850328). (+/-)-U-50488 Hydrochloride is a selective κ-opioid agonist and an analgesic agent (1,2). (+/-)-U-50488 Hydrochloride can be used to analyze structure- activity relationships of kappa opioid receptors.
Supplier | BOC Sciences |
---|---|
Product # | BB063182 |
Pricing | Inquire |
Cas | 1339332-99-8 |
Molecular Weight | 336.42 + 36.46 |
Molecular Formula | C19H26F2N2O·HCl |
Canonical SMILES | CN(C1CCCCC1N2CCCC2)C(=O)CC3=CC(=C(C=C3)F)F.Cl |