Daunorubicin Impurity 7
Daunorubicin Impurity 7 is an impurity of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 131086-18-5 |
| Pricing | Inquire |
| Cas | 131086-18-5 |
| Molecular Weight | 680.55 |
| Molecular Formula | C31H38BrNO11 |
| Canonical SMILES | O=C1C=2C=CC=C(OC)C2C(=O)C=3C(O)=C4C(=C(O)C13)CC(O)(CC4OC5OC(C)C(O)C(N)C5)C(OCC)(OCC)CBr |