2',3',5'-Tri-O-benzoyl-5-methoxyuridine
2',3',5'-Tri-O-benzoyl-5-methoxyuridine, a highly potent antiviral compound exclusively employed in the biomedical sector, unveils astounding therapeutic potential against a myriad of viral infections. Its efficacy is particularly pronounced in combatting the notorious herpes simplex virus (HSV) and the varicella-zoster virus (VZV). This compound adeptly impedes viral replication by adroitly directing its attention towards viral DNA synthesis and skillfully hindering viral gene expression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37805-86-0 |
| Pricing | Inquire |
| Cas | 37805-86-0 |
| Molecular Weight | 586.55 |
| Molecular Formula | C31H26N2O10 |
| Canonical SMILES | COC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |