Verapamil Impurity O
An impurity of Verapamil. Verapamil is a medication used for the treatment of high blood pressure, chest pain from not enough blood flow to the heart, and supraventricular tachycardia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 959011-16-6 |
| Pricing | Inquire |
| Cas | 959011-16-6 |
| Molecular Weight | 454.61 |
| Molecular Formula | C27H38N2O4 |
| Canonical SMILES | CCCC(CCCN(C)CCC1=CC(=C(C=C1)OC)OC)(C#N)C2=CC(=C(C=C2)OC)OC |