Dacomitinib Impurity SFAJ
One of the impurities of Dacomitinib. Dacomitinib, aslo known as PF-299 and PF-00299804 or PF299804, is an orally bioavailable, highly selective, second-generation small-molecule inhibitor of the pan-epidermal growth factor receptor (EGFR) family of tyrosine kinases (ErbB family) with potential antineoplastic activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2117703-26-9 |
| Pricing | Inquire |
| Cas | 2117703-26-9 |
| Molecular Weight | 302.28 |
| Molecular Formula | C15H12F2N4O |
| Canonical SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)F)N |