Aurachin C
Aurachin C is a quinoline compound produced by Stigmatella aurantiaca Sg al5. It has the activity of inhibiting gram-positive bacteria and a few yeasts and filamentous fungi, and can block the NADH oxidation of bovine heart microsomal particles.
Supplier | BOC Sciences |
---|---|
Product # | BBF-00131 |
Pricing | Inquire |
Cas | 108354-14-9 |
Molecular Weight | 379.53 |
Molecular Formula | C25H33NO2 |
Canonical SMILES | CC1=C(C(=O)C2=CC=CC=C2N1O)CC=C(C)CCC=C(C)CCC=C(C)C |