4-Nitrophenyl b-L-fucopyranoside
4-Nitrophenyl b-L-fucopyranoside is a chemical compound widely applied in the biomedical industry. It is commonly used as a substrate for determining the activity of enzymes like β-L-fucosidases. This compound finds use in studying enzyme kinetics and the research of these enzymes in diseases such as cancer and metabolic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 22153-71-5 |
| Pricing | Inquire |
| Cas | 22153-71-5 |
| Molecular Weight | 285.25 |
| Molecular Formula | C12H15NO7 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |