Galactosylated L-tyrosine
Galactosylated L-tyrosine is a synthetic peptide that has shown potential as a drug delivery system for targeting hepatocytes in the treatment of liver diseases. It has also been studied as a carrier for anticancer drugs to specifically target cancer cells expressing specific receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 169061-81-8 |
| Pricing | Inquire |
| Cas | 169061-81-8 |
| Molecular Weight | 733.71 |
| Molecular Formula | C38H39NO14 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2=CC=C(C=C2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)OC(=O)C)OC(=O)C)OC(=O)C |