Fexofenadine EP Impurity B
Fexofenadine EP Impurity B is an impurity of Fexofenadine, which is a histamine H1 receptor antagonist used for the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 479035-75-1 |
| Pricing | Inquire |
| Cas | 479035-75-1 |
| Molecular Weight | 501.67 |
| Molecular Formula | C32H39NO4 |
| Canonical SMILES | CC(C)(C1=CC=CC(=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C(=O)O |