3'-β-Amino-2',3'-dideoxy-5'-O-methoxytrityl-5-methyluridine
3'-β-Amino-2',3'-dideoxy-5'-O-methoxytrityl-5-methyluridine, an intriguing and formidable nucleoside derivative, triumphantly thrives in the biomedical realm where it valiantly combats viral infections and specific cancer forms. Astonishingly, this compound showcases remarkable antiviral prowess against RNA viruses, thereby sparking immense interest as a potential candidate for antitumor interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 204688-08-4 |
| Pricing | Inquire |
| Cas | 204688-08-4 |
| Molecular Weight | 483.56 |
| Molecular Formula | C29H29N3O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)N |