A-25822 A
A-25822 A is an azasteroid antibiotic produced by Geotrichum flavobrienneum. It has anti-fungal activity, and the MIC for fungi such as Candida albicans, Cryptococcus neoformans, Trichophyton mentacea, Phytoplastria, Saccharomyces cerevisiae, Saccharomyces cerevisiae, Microsporum, etc. is 0.321-1.25 μg/mL. Antibacterial activity is weak.
Supplier | BOC Sciences |
---|---|
Product # | BBF-03132 |
Pricing | Inquire |
Cas | 50686-99-2 |
Molecular Weight | 439.71 |
Molecular Formula | C30H49NO |
Canonical SMILES | CC(C)C(=C)CCC(C)C1CCN=C2C1(CCC3=C2CCC4C3(CCC(C4(C)C)O)C)C |