1-chloro-6-(5-ethynylthiophen-2-yl)hexa-3,5-diyn-2-ol
1-Chloro-6-(5-ethynylthiophen-2-yl)hexa-3,5-diyn-2-ol is an exquisite natural compound exhibiting remarkable potential to study a myriad of ailments. Functioning as a potent enzyme inhibitor, it orchestrates a profound interference in the intricate mechanisms implicated in the development of specific malignancies and inflammatory disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4363 |
| Pricing | Inquire |
| Cas | 78876-53-6 |
| Molecular Weight | 234.697 |
| Molecular Formula | C12H7ClOS |
| Canonical SMILES | C#CC1=CC=C(S1)C#CC#CC(CCl)O |