2,4-Dimethylbenzenesulfonyl chloride
2,4-Dimethylbenzenesulfonyl chloride (CAS# 609-60-9) is used as a reagent in the synthesis of dimethyl benzimidazolones as potent and selective inhibitors of BRPF1 bromodomain. 2,4-Dimethylbenzenesulfonyl Chloride is also used as a reagent in the synthesis of quinazoline analogs as glucocerebrosidase inhibitors with chaperone activity for the treatment of Gaucher disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 609-60-9 |
| Pricing | Inquire |
| Cas | 609-60-9 |
| Molecular Weight | 204.67 |
| Molecular Formula | C8H9ClO2S |
| Canonical SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)C |