2-Nitrophenyl b-D-fucopyranoside
2-Nitrophenyl b-D-fucopyranoside is a biomedicine used in the diagnosis and treatment of various diseases. It is primarily utilized as a substrate in enzymatic assays to analyze and detect the activity of specific enzymes associated with metabolic disorders and infectious diseases. This product aids in the research and development of novel drugs targeting these enzymes, contributing to advancements in the biomedical field.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1154-94-5 |
| Pricing | Inquire |
| Cas | 1154-94-5 |
| Molecular Weight | 285.25 |
| Molecular Formula | C12H15NO7 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CC=CC=C2[N+](=O)[O-])O)O)O |