2-Tributylstannylbenzo[b]thiophene
2-Tributylstannylbenzo[b]thiophene is a biomedical chemical. It has excellent efficacy in eradicating fungal infections, especially Candida-related infections, demonstrating its strength through potent antifungal properties. Its mechanism of action is to inhibit the growth and expansion of these fungi, providing a promising drug development idea for individuals suffering from fungal-related diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 148961-88-0 |
| Pricing | Inquire |
| Cas | 148961-88-0 |
| Molecular Weight | 423.24 |
| Molecular Formula | C20H32SSn |
| Canonical SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC2=CC=CC=C2S1 |