2,6-Dichloro-9-(2'-deoxy-b-D-ribofuranosyl)purine
2,6-Dichloro-9-(2'-deoxy-b-D-ribofuranosyl)purine is a highly potent antiviral compound, exhibiting exceptional efficacy in the research of combatting an array of viral ailments such as herpes simplex virus and varicella-zoster virus infections. Its mechanism of action prevails by meticulously impeding viral DNA replication, effectively targeting the pivotal enzymes accountable for this replication process.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37390-66-2 |
| Pricing | Inquire |
| Cas | 37390-66-2 |
| Molecular Weight | 305.12 |
| Molecular Formula | C10H10Cl2N4O3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(N=C3Cl)Cl)CO)O |