N-Acetyl-9-azido-9-deoxy-neuraminic acid
N-Acetyl-9-azido-9-deoxy-neuraminic acid is an indispensable compound hailing from the biomedical realm. Fascinatingly intricate, this modified sialic acid demonstrates immense potential in the domains of pharmaceutical progress and malady mitigation. Despite its unassuming appearance, this marvel of chemical architecture exhibits remarkable prospects for pinpointing and combating anomalous sialic acid metabolism-linked ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76487-51-9 |
| Pricing | Inquire |
| Cas | 76487-51-9 |
| Molecular Weight | 334.28 |
| Molecular Formula | C11H18N4O8 |
| Canonical SMILES | CC(=O)NC(C(CC(=O)C(=O)O)O)C(C(C(CN=[N+]=[N-])O)O)O |