5'-O-Levulinoylthymidine 3'-CE phosphoramidite
5'-O-Levulinoylthymidine 3'-CE phosphoramidite, an indispensable asset harnessed within the ever-evolving realms of the biomedical sector, emanates a profound influence upon the synthesis of tailored oligonucleotides. Reverberating as a catalyst for innovation, its innate ability to bestow a 5'-O-levulinoyl modification, combined with its role as a safeguarding entity during solid-phase synthesis, elicits transformative outcomes. Unveiling an extensive repertoire, this wondrous creation orchestrates a symphony of advancements in targeted drug delivery, gene therapy, and the diagnostic landscape.
| Supplier | BOC Sciences |
|---|---|
| Product # | 581076-14-4 |
| Pricing | Inquire |
| Cas | 581076-14-4 |
| Molecular Weight | 540.55 |
| Molecular Formula | C24H37N4O8P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(=O)CCC(=O)C)OP(N(C(C)C)C(C)C)OCCC#N |