Progesterone EP Impurity I
Progesterone EP Impurity I is an impurity of Progesterone, which is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24254-01-1 |
| Pricing | Inquire |
| Cas | 24254-01-1 |
| Molecular Weight | 328.49 |
| Molecular Formula | C22H32O2 |
| Canonical SMILES | CC(C=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |