5'-(Furan-2-yl)-2'-O-methyluridine
5'-(Furan-2-yl)-2'-O-methyluridine, an extraordinary biomedicine compound, exhibits remarkable efficacy in combating a wide range of viral infections, such as hepatitis C and influenza. By impeding RNA synthesis, this nucleoside analog effectively obstructs viral replication, thereby curbing their proliferation. Distinguished by its distinctive structure, it precisely targets viral polymerases, presenting a highly promising and pioneering approach to antiviral therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-32-4 |
| Pricing | Inquire |
| Cas | 2095417-32-4 |
| Molecular Weight | 324.29 |
| Molecular Formula | C14H16N2O7 |
| Canonical SMILES | COC1C(C(OC1N2C=C(C(=O)NC2=O)C3=CC=CO3)CO)O |