Fmoc-NH-(PEG)10-CH2CH2COOH

Supplier Alfa Chemistry
Product # ACM2101563453-1
CAS # 2101563-45-3
Pricing Inquire
Synonyms 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31,34-undecaoxa-4-azaheptatriacontan-37-oic acid
IUPAC Name 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
Purity Peak Area by HPLC ≥95%
MolecularFormula C38H57NO14
MolecularWeight 751.8
Application Fmoc-NH-PEG10-CH2CH2COOH has a wide range of applications in scientific experiments, including drug delivery, diagnostics, and imaging. Its hydrophilic and biocompatible nature makes it an ideal polymer for the synthesis of nanoparticles or micelles that can carry hydrophobic drugs and improve their solubility and bioavailability in biological systems. Its carboxylic acid group can also be used for the conjugation of various targeting ligands, such as antibodies or peptides, that can improve the specificity and efficiency of drug delivery.
Feedback