Potassium 2-methoxypyrimidin-5-yl-5-trifluoroborate
Potassium 2-methoxypyrimidin-5-yl-5-trifluoroborate is a bioactive chemical entity that stands as an instrumental pharmacological adjunct in the remedy of diverse pathological conditions. Emanating from its intricate mode of action, it remarkably suppresses the functioning of selective enzymes, pivotal in the incessant growth of malignant neoplastic cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1111732-99-0 |
| Pricing | Inquire |
| Cas | 1111732-99-0 |
| Molecular Weight | 216.01 |
| Molecular Formula | C5H5BF3KN2O |
| Canonical SMILES | [B-](C1=CN=C(N=C1)OC)(F)(F)F.[K+] |