Isopseudocyphellarin A
In the research of biomedicine,opseudocyphellarin A has emerged as a highly auspicious compound. Its intricate chemical configuration presents a compelling platform for harnessing notable anti-neoplastic attributes, specifically catering to the demise of mammary carcinoma cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 113706-24-4 |
| Pricing | Inquire |
| Cas | 113706-24-4 |
| Molecular Weight | 402.39 |
| Molecular Formula | C21H22O8 |
| Canonical SMILES | CC1=C(C(=C(C(=C1C(=O)OC)O)C)OC(=O)C2=C(C(=C(C(=C2C)C=O)O)C)O)C |